About 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide
3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide (PubChem CID 175856674) has the molecular formula C11H8N4OS
and a molecular weight of 244.28 g/mol. Its IUPAC name is 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide.
Molecular Properties
| Compound Name | 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide |
| PubChem CID | 175856674 |
| Molecular Formula | C11H8N4OS |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide |
| SMILES | NC(=O)c1cn2c(-c3ccccn3)csc2n1 |
| InChI | InChI=1S/C11H8N4OS/c12-10(16)8-5-15-9(6-17-11(15)14-8)7-3-1-2-4-13-7/h1-6H,(H2,12,16) |
| InChIKey | QSAHKUAUNKPOML-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 73.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide?
The IUPAC name of 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide (CID 175856674) is 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide.
What is the SMILES notation for 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide?
The canonical SMILES for 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide is NC(=O)c1cn2c(-c3ccccn3)csc2n1.
What is the InChIKey of 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide?
The InChIKey is QSAHKUAUNKPOML-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4OS/c12-10(16)8-5-15-9(6-17-11(15)14-8)7-3-1-2-4-13-7/h1-6H,(H2,12,16).
What are the key properties of 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide?
3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide has a molecular weight of 244.28 g/mol, XLogP of 1.56, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide is sourced from PubChem (CID 175856674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).