C11H8N4OS — CID 175856674
3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide (PubChem CID 175856674) has the molecular formula C11H8N4OS and a molecular weight of 244.28 g/mol. Its IUPAC name is 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide.
| Compound Name | 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide |
|---|---|
| PubChem CID | 175856674 |
| Molecular Formula | C11H8N4OS |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide |
| SMILES | NC(=O)c1cn2c(-c3ccccn3)csc2n1 |
| InChI | InChI=1S/C11H8N4OS/c12-10(16)8-5-15-9(6-17-11(15)14-8)7-3-1-2-4-13-7/h1-6H,(H2,12,16) |
| InChIKey | QSAHKUAUNKPOML-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 73.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |