About 1-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]triazole-4-carboxamide
1-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]triazole-4-carboxamide (PubChem CID 146130029) has the molecular formula C12H10N6OS
and a molecular weight of 286.32 g/mol. Its IUPAC name is 1-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]triazole-4-carboxamide.
Molecular Properties
| Compound Name | 1-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]triazole-4-carboxamide |
| PubChem CID | 146130029 |
| Molecular Formula | C12H10N6OS |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 1-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]triazole-4-carboxamide |
| SMILES | NC(=O)c1cn(Cc2csc(-c3ccccn3)n2)nn1 |
| InChI | InChI=1S/C12H10N6OS/c13-11(19)10-6-18(17-16-10)5-8-7-20-12(15-8)9-3-1-2-4-14-9/h1-4,6-7H,5H2,(H2,13,19) |
| InChIKey | WLGFXQYEILZJGZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]triazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]triazole-4-carboxamide?
The IUPAC name of 1-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]triazole-4-carboxamide (CID 146130029) is 1-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]triazole-4-carboxamide.
What is the SMILES notation for 1-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]triazole-4-carboxamide?
The canonical SMILES for 1-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]triazole-4-carboxamide is NC(=O)c1cn(Cc2csc(-c3ccccn3)n2)nn1.
What is the InChIKey of 1-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]triazole-4-carboxamide?
The InChIKey is WLGFXQYEILZJGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N6OS/c13-11(19)10-6-18(17-16-10)5-8-7-20-12(15-8)9-3-1-2-4-14-9/h1-4,6-7H,5H2,(H2,13,19).
What are the key properties of 1-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]triazole-4-carboxamide?
1-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]triazole-4-carboxamide has a molecular weight of 286.32 g/mol, XLogP of 0.94, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]triazole-4-carboxamide is sourced from PubChem (CID 146130029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).