C13H16N4OS — CID 115749394
3-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methylamino]butanamide (PubChem CID 115749394) has the molecular formula C13H16N4OS and a molecular weight of 276.37 g/mol. Its IUPAC name is 3-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methylamino]butanamide.
| Compound Name | 3-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methylamino]butanamide |
|---|---|
| PubChem CID | 115749394 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 3-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methylamino]butanamide |
| SMILES | CC(CC(N)=O)NCc1csc(-c2ccccn2)n1 |
| InChI | InChI=1S/C13H16N4OS/c1-9(6-12(14)18)16-7-10-8-19-13(17-10)11-4-2-3-5-15-11/h2-5,8-9,16H,6-7H2,1H3,(H2,14,18) |
| InChIKey | CNCVDAXWHOOHHK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |