C10H8N4O2S — CID 110471210
2-(pyridine-2-carbonylamino)-1,3-thiazole-4-carboxamide (PubChem CID 110471210) has the molecular formula C10H8N4O2S and a molecular weight of 248.27 g/mol. Its IUPAC name is 2-(pyridine-2-carbonylamino)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(pyridine-2-carbonylamino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 110471210 |
| Molecular Formula | C10H8N4O2S |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 2-(pyridine-2-carbonylamino)-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1csc(NC(=O)c2ccccn2)n1 |
| InChI | InChI=1S/C10H8N4O2S/c11-8(15)7-5-17-10(13-7)14-9(16)6-3-1-2-4-12-6/h1-5H,(H2,11,15)(H,13,14,16) |
| InChIKey | PFKVYDOLFRMYHA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |