C9H7N3O2S2 — CID 16915451
2-(thiophene-2-carbonylamino)-1,3-thiazole-4-carboxamide (PubChem CID 16915451) has the molecular formula C9H7N3O2S2 and a molecular weight of 253.31 g/mol. Its IUPAC name is 2-(thiophene-2-carbonylamino)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(thiophene-2-carbonylamino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 16915451 |
| Molecular Formula | C9H7N3O2S2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | 2-(thiophene-2-carbonylamino)-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1csc(NC(=O)c2cccs2)n1 |
| InChI | InChI=1S/C9H7N3O2S2/c10-7(13)5-4-16-9(11-5)12-8(14)6-2-1-3-15-6/h1-4H,(H2,10,13)(H,11,12,14) |
| InChIKey | NFCDLTXEVVYOCP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |