About benzoic acid;pyridine-2-carboxamide
benzoic acid;pyridine-2-carboxamide (PubChem CID 67821051) has the molecular formula C13H12N2O3
and a molecular weight of 244.25 g/mol. Its IUPAC name is benzoic acid;pyridine-2-carboxamide.
Molecular Properties
| Compound Name | benzoic acid;pyridine-2-carboxamide |
| PubChem CID | 67821051 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | benzoic acid;pyridine-2-carboxamide |
| SMILES | NC(=O)c1ccccn1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C7H6O2.C6H6N2O/c8-7(9)6-4-2-1-3-5-6;7-6(9)5-3-1-2-4-8-5/h1-5H,(H,8,9);1-4H,(H2,7,9) |
| InChIKey | COOMRDOXJODJJW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzoic acid;pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;pyridine-2-carboxamide?
The IUPAC name of benzoic acid;pyridine-2-carboxamide (CID 67821051) is benzoic acid;pyridine-2-carboxamide.
What is the SMILES notation for benzoic acid;pyridine-2-carboxamide?
The canonical SMILES for benzoic acid;pyridine-2-carboxamide is NC(=O)c1ccccn1.O=C(O)c1ccccc1.
What is the InChIKey of benzoic acid;pyridine-2-carboxamide?
The InChIKey is COOMRDOXJODJJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C6H6N2O/c8-7(9)6-4-2-1-3-5-6;7-6(9)5-3-1-2-4-8-5/h1-5H,(H,8,9);1-4H,(H2,7,9).
What are the key properties of benzoic acid;pyridine-2-carboxamide?
benzoic acid;pyridine-2-carboxamide has a molecular weight of 244.25 g/mol, XLogP of 1.57, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;pyridine-2-carboxamide is sourced from PubChem (CID 67821051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).