About benzoic acid;pyrimidine-4-carboxamide
benzoic acid;pyrimidine-4-carboxamide (PubChem CID 174949341) has the molecular formula C12H11N3O3
and a molecular weight of 245.24 g/mol. Its IUPAC name is benzoic acid;pyrimidine-4-carboxamide.
Molecular Properties
| Compound Name | benzoic acid;pyrimidine-4-carboxamide |
| PubChem CID | 174949341 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | benzoic acid;pyrimidine-4-carboxamide |
| SMILES | NC(=O)c1ccncn1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C7H6O2.C5H5N3O/c8-7(9)6-4-2-1-3-5-6;6-5(9)4-1-2-7-3-8-4/h1-5H,(H,8,9);1-3H,(H2,6,9) |
| InChIKey | ZINXCTPMGFGJBU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzoic acid;pyrimidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;pyrimidine-4-carboxamide?
The IUPAC name of benzoic acid;pyrimidine-4-carboxamide (CID 174949341) is benzoic acid;pyrimidine-4-carboxamide.
What is the SMILES notation for benzoic acid;pyrimidine-4-carboxamide?
The canonical SMILES for benzoic acid;pyrimidine-4-carboxamide is NC(=O)c1ccncn1.O=C(O)c1ccccc1.
What is the InChIKey of benzoic acid;pyrimidine-4-carboxamide?
The InChIKey is ZINXCTPMGFGJBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C5H5N3O/c8-7(9)6-4-2-1-3-5-6;6-5(9)4-1-2-7-3-8-4/h1-5H,(H,8,9);1-3H,(H2,6,9).
What are the key properties of benzoic acid;pyrimidine-4-carboxamide?
benzoic acid;pyrimidine-4-carboxamide has a molecular weight of 245.24 g/mol, XLogP of 0.96, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;pyrimidine-4-carboxamide is sourced from PubChem (CID 174949341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).