C11H17N3O3 — CID 175209186
tert-butyl carbamate;pyridine-2-carboxamide (PubChem CID 175209186) has the molecular formula C11H17N3O3 and a molecular weight of 239.28 g/mol. Its IUPAC name is tert-butyl carbamate;pyridine-2-carboxamide.
| Compound Name | tert-butyl carbamate;pyridine-2-carboxamide |
|---|---|
| PubChem CID | 175209186 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | tert-butyl carbamate;pyridine-2-carboxamide |
| SMILES | CC(C)(C)OC(N)=O.NC(=O)c1ccccn1 |
| InChI | InChI=1S/C6H6N2O.C5H11NO2/c7-6(9)5-3-1-2-4-8-5;1-5(2,3)8-4(6)7/h1-4H,(H2,7,9);1-3H3,(H2,6,7) |
| InChIKey | XSEDJNYDNVJSHF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |