About tert-butyl carbamate;1-methyl-4-phenylbenzene
tert-butyl carbamate;1-methyl-4-phenylbenzene (PubChem CID 174572065) has the molecular formula C18H23NO2
and a molecular weight of 285.39 g/mol. Its IUPAC name is tert-butyl carbamate;1-methyl-4-phenylbenzene.
Molecular Properties
| Compound Name | tert-butyl carbamate;1-methyl-4-phenylbenzene |
| PubChem CID | 174572065 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | tert-butyl carbamate;1-methyl-4-phenylbenzene |
| SMILES | CC(C)(C)OC(N)=O.Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H12.C5H11NO2/c1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;1-5(2,3)8-4(6)7/h2-10H,1H3;1-3H3,(H2,6,7) |
| InChIKey | JQTICJDBISOOLU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl carbamate;1-methyl-4-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl carbamate;1-methyl-4-phenylbenzene?
The IUPAC name of tert-butyl carbamate;1-methyl-4-phenylbenzene (CID 174572065) is tert-butyl carbamate;1-methyl-4-phenylbenzene.
What is the SMILES notation for tert-butyl carbamate;1-methyl-4-phenylbenzene?
The canonical SMILES for tert-butyl carbamate;1-methyl-4-phenylbenzene is CC(C)(C)OC(N)=O.Cc1ccc(-c2ccccc2)cc1.
What is the InChIKey of tert-butyl carbamate;1-methyl-4-phenylbenzene?
The InChIKey is JQTICJDBISOOLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.C5H11NO2/c1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;1-5(2,3)8-4(6)7/h2-10H,1H3;1-3H3,(H2,6,7).
What are the key properties of tert-butyl carbamate;1-methyl-4-phenylbenzene?
tert-butyl carbamate;1-methyl-4-phenylbenzene has a molecular weight of 285.39 g/mol, XLogP of 4.54, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl carbamate;1-methyl-4-phenylbenzene is sourced from PubChem (CID 174572065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).