About tert-butyl carbamate;2-phenylquinoline
tert-butyl carbamate;2-phenylquinoline (PubChem CID 175279486) has the molecular formula C20H22N2O2
and a molecular weight of 322.41 g/mol. Its IUPAC name is tert-butyl carbamate;2-phenylquinoline.
Molecular Properties
| Compound Name | tert-butyl carbamate;2-phenylquinoline |
| PubChem CID | 175279486 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | tert-butyl carbamate;2-phenylquinoline |
| SMILES | CC(C)(C)OC(N)=O.c1ccc(-c2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C15H11N.C5H11NO2/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15;1-5(2,3)8-4(6)7/h1-11H;1-3H3,(H2,6,7) |
| InChIKey | MKZIEOWRMQIPTN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl carbamate;2-phenylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl carbamate;2-phenylquinoline?
The IUPAC name of tert-butyl carbamate;2-phenylquinoline (CID 175279486) is tert-butyl carbamate;2-phenylquinoline.
What is the SMILES notation for tert-butyl carbamate;2-phenylquinoline?
The canonical SMILES for tert-butyl carbamate;2-phenylquinoline is CC(C)(C)OC(N)=O.c1ccc(-c2ccc3ccccc3n2)cc1.
What is the InChIKey of tert-butyl carbamate;2-phenylquinoline?
The InChIKey is MKZIEOWRMQIPTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N.C5H11NO2/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15;1-5(2,3)8-4(6)7/h1-11H;1-3H3,(H2,6,7).
What are the key properties of tert-butyl carbamate;2-phenylquinoline?
tert-butyl carbamate;2-phenylquinoline has a molecular weight of 322.41 g/mol, XLogP of 4.78, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl carbamate;2-phenylquinoline is sourced from PubChem (CID 175279486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).