carbonic acid;2-(3,4-dimethoxyphenyl)quinoline

C18H17NO5 — CID 70367637

IUPACcarbonic acid;2-(3,4-dimethoxyphenyl)quinoline
SMILESCOc1ccc(-c2ccc3ccccc3n2)cc1OC.O=C(O)O
InChIInChI=1S/C17H15NO2.CH2O3/c1-19-16-10-8-13(11-17(16)20-2)15-9-7-12-5-3-4-6-14(12)18-15;2-1(3)4/h3-11H,1-2H3;(H2,2,3,4)
InChIKeyIGJRLWFAOBJLTK-UHFFFAOYSA-N
MW327.34 g/mol
LogP4.14
Rot. Bonds3

About carbonic acid;2-(3,4-dimethoxyphenyl)quinoline

carbonic acid;2-(3,4-dimethoxyphenyl)quinoline (PubChem CID 70367637) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is carbonic acid;2-(3,4-dimethoxyphenyl)quinoline.

Molecular Properties

Compound Namecarbonic acid;2-(3,4-dimethoxyphenyl)quinoline
PubChem CID70367637
Molecular FormulaC18H17NO5
Molecular Weight327.34 g/mol
Exact Mass327.11
IUPAC Namecarbonic acid;2-(3,4-dimethoxyphenyl)quinoline
SMILESCOc1ccc(-c2ccc3ccccc3n2)cc1OC.O=C(O)O
InChIInChI=1S/C17H15NO2.CH2O3/c1-19-16-10-8-13(11-17(16)20-2)15-9-7-12-5-3-4-6-14(12)18-15;2-1(3)4/h3-11H,1-2H3;(H2,2,3,4)
InChIKeyIGJRLWFAOBJLTK-UHFFFAOYSA-N
XLogP4.14
TPSA88.88 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500327.34
LogP ≤ 54.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze carbonic acid;2-(3,4-dimethoxyphenyl)quinoline with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbonic acid;2-(3,4-dimethoxyphenyl)quinoline?
The IUPAC name of carbonic acid;2-(3,4-dimethoxyphenyl)quinoline (CID 70367637) is carbonic acid;2-(3,4-dimethoxyphenyl)quinoline.
What is the SMILES notation for carbonic acid;2-(3,4-dimethoxyphenyl)quinoline?
The canonical SMILES for carbonic acid;2-(3,4-dimethoxyphenyl)quinoline is COc1ccc(-c2ccc3ccccc3n2)cc1OC.O=C(O)O.
What is the InChIKey of carbonic acid;2-(3,4-dimethoxyphenyl)quinoline?
The InChIKey is IGJRLWFAOBJLTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO2.CH2O3/c1-19-16-10-8-13(11-17(16)20-2)15-9-7-12-5-3-4-6-14(12)18-15;2-1(3)4/h3-11H,1-2H3;(H2,2,3,4).
What are the key properties of carbonic acid;2-(3,4-dimethoxyphenyl)quinoline?
carbonic acid;2-(3,4-dimethoxyphenyl)quinoline has a molecular weight of 327.34 g/mol, XLogP of 4.14, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;2-(3,4-dimethoxyphenyl)quinoline is sourced from PubChem (CID 70367637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).