C25H23NO4 — CID 3648105
ethyl 2-[3-(3,4-dimethoxyphenyl)benzo[f]quinolin-1-yl]acetate (PubChem CID 3648105) has the molecular formula C25H23NO4 and a molecular weight of 401.46 g/mol. Its IUPAC name is ethyl 2-[3-(3,4-dimethoxyphenyl)benzo[f]quinolin-1-yl]acetate.
| Compound Name | ethyl 2-[3-(3,4-dimethoxyphenyl)benzo[f]quinolin-1-yl]acetate |
|---|---|
| PubChem CID | 3648105 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | ethyl 2-[3-(3,4-dimethoxyphenyl)benzo[f]quinolin-1-yl]acetate |
| SMILES | CCOC(=O)Cc1cc(-c2ccc(OC)c(OC)c2)nc2ccc3ccccc3c12 |
| InChI | InChI=1S/C25H23NO4/c1-4-30-24(27)15-18-13-21(17-10-12-22(28-2)23(14-17)29-3)26-20-11-9-16-7-5-6-8-19(16)25(18)20/h5-14H,4,15H2,1-3H3 |
| InChIKey | MGSOLVHHSIDABL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|