C24H24N2O3 — CID 3494981
2-(3,4-dimethoxyphenyl)-N,N-bis(prop-2-enyl)quinoline-4-carboxamide (PubChem CID 3494981) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N,N-bis(prop-2-enyl)quinoline-4-carboxamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N,N-bis(prop-2-enyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3494981 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N,N-bis(prop-2-enyl)quinoline-4-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)c1cc(-c2ccc(OC)c(OC)c2)nc2ccccc12 |
| InChI | InChI=1S/C24H24N2O3/c1-5-13-26(14-6-2)24(27)19-16-21(25-20-10-8-7-9-18(19)20)17-11-12-22(28-3)23(15-17)29-4/h5-12,15-16H,1-2,13-14H2,3-4H3 |
| InChIKey | KMLJXKAQKVRPQK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|