C25H23N3O5 — CID 29169171
2-(3,4-dimethoxyphenyl)-N'-(2,5-dimethylfuran-3-carbonyl)quinoline-4-carbohydrazide (PubChem CID 29169171) has the molecular formula C25H23N3O5 and a molecular weight of 445.48 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N'-(2,5-dimethylfuran-3-carbonyl)quinoline-4-carbohydrazide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N'-(2,5-dimethylfuran-3-carbonyl)quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 29169171 |
| Molecular Formula | C25H23N3O5 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N'-(2,5-dimethylfuran-3-carbonyl)quinoline-4-carbohydrazide |
| SMILES | COc1ccc(-c2cc(C(=O)NNC(=O)c3cc(C)oc3C)c3ccccc3n2)cc1OC |
| InChI | InChI=1S/C25H23N3O5/c1-14-11-18(15(2)33-14)24(29)27-28-25(30)19-13-21(26-20-8-6-5-7-17(19)20)16-9-10-22(31-3)23(12-16)32-4/h5-13H,1-4H3,(H,27,29)(H,28,30) |
| InChIKey | LUGBZYCQELFZAY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|