C24H27N3O4 — CID 55376531
2-(3,4-dimethoxyphenyl)-N'-(3,3-dimethylbutanoyl)quinoline-4-carbohydrazide (PubChem CID 55376531) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N'-(3,3-dimethylbutanoyl)quinoline-4-carbohydrazide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N'-(3,3-dimethylbutanoyl)quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 55376531 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N'-(3,3-dimethylbutanoyl)quinoline-4-carbohydrazide |
| SMILES | COc1ccc(-c2cc(C(=O)NNC(=O)CC(C)(C)C)c3ccccc3n2)cc1OC |
| InChI | InChI=1S/C24H27N3O4/c1-24(2,3)14-22(28)26-27-23(29)17-13-19(25-18-9-7-6-8-16(17)18)15-10-11-20(30-4)21(12-15)31-5/h6-13H,14H2,1-5H3,(H,26,28)(H,27,29) |
| InChIKey | VVWIGMCDSWHZOF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|