C27H22N2O6 — CID 42968678
(2-benzamido-2-oxoethyl) 2-(3,4-dimethoxyphenyl)quinoline-4-carboxylate (PubChem CID 42968678) has the molecular formula C27H22N2O6 and a molecular weight of 470.48 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 2-(3,4-dimethoxyphenyl)quinoline-4-carboxylate.
| Compound Name | (2-benzamido-2-oxoethyl) 2-(3,4-dimethoxyphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 42968678 |
| Molecular Formula | C27H22N2O6 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 2-(3,4-dimethoxyphenyl)quinoline-4-carboxylate |
| SMILES | COc1ccc(-c2cc(C(=O)OCC(=O)NC(=O)c3ccccc3)c3ccccc3n2)cc1OC |
| InChI | InChI=1S/C27H22N2O6/c1-33-23-13-12-18(14-24(23)34-2)22-15-20(19-10-6-7-11-21(19)28-22)27(32)35-16-25(30)29-26(31)17-8-4-3-5-9-17/h3-15H,16H2,1-2H3,(H,29,30,31) |
| InChIKey | JIJFHPVEUCCIJW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |