C29H28N2O5 — CID 2093536
[2-oxo-2-(3-phenylpropylamino)ethyl] 2-(3,4-dimethoxyphenyl)quinoline-4-carboxylate (PubChem CID 2093536) has the molecular formula C29H28N2O5 and a molecular weight of 484.55 g/mol. Its IUPAC name is [2-oxo-2-(3-phenylpropylamino)ethyl] 2-(3,4-dimethoxyphenyl)quinoline-4-carboxylate.
| Compound Name | [2-oxo-2-(3-phenylpropylamino)ethyl] 2-(3,4-dimethoxyphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2093536 |
| Molecular Formula | C29H28N2O5 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | [2-oxo-2-(3-phenylpropylamino)ethyl] 2-(3,4-dimethoxyphenyl)quinoline-4-carboxylate |
| SMILES | COc1ccc(-c2cc(C(=O)OCC(=O)NCCCc3ccccc3)c3ccccc3n2)cc1OC |
| InChI | InChI=1S/C29H28N2O5/c1-34-26-15-14-21(17-27(26)35-2)25-18-23(22-12-6-7-13-24(22)31-25)29(33)36-19-28(32)30-16-8-11-20-9-4-3-5-10-20/h3-7,9-10,12-15,17-18H,8,11,16,19H2,1-2H3,(H,30,32) |
| InChIKey | GZCVRJUMLFCTAF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|