C22H19BrN2O — CID 3423511
2-(3-bromophenyl)-N,N-bis(prop-2-enyl)quinoline-4-carboxamide (PubChem CID 3423511) has the molecular formula C22H19BrN2O and a molecular weight of 407.31 g/mol. Its IUPAC name is 2-(3-bromophenyl)-N,N-bis(prop-2-enyl)quinoline-4-carboxamide.
| Compound Name | 2-(3-bromophenyl)-N,N-bis(prop-2-enyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3423511 |
| Molecular Formula | C22H19BrN2O |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 2-(3-bromophenyl)-N,N-bis(prop-2-enyl)quinoline-4-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)c1cc(-c2cccc(Br)c2)nc2ccccc12 |
| InChI | InChI=1S/C22H19BrN2O/c1-3-12-25(13-4-2)22(26)19-15-21(16-8-7-9-17(23)14-16)24-20-11-6-5-10-18(19)20/h3-11,14-15H,1-2,12-13H2 |
| InChIKey | CHZQZRBVWZSWHZ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|