C22H10BrF5N2O — CID 3535880
2-(3-bromophenyl)-N-(2,3,4,5,6-pentafluorophenyl)quinoline-4-carboxamide (PubChem CID 3535880) has the molecular formula C22H10BrF5N2O and a molecular weight of 493.23 g/mol. Its IUPAC name is 2-(3-bromophenyl)-N-(2,3,4,5,6-pentafluorophenyl)quinoline-4-carboxamide.
| Compound Name | 2-(3-bromophenyl)-N-(2,3,4,5,6-pentafluorophenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3535880 |
| Molecular Formula | C22H10BrF5N2O |
| Molecular Weight | 493.23 g/mol |
| Exact Mass | 491.99 |
| IUPAC Name | 2-(3-bromophenyl)-N-(2,3,4,5,6-pentafluorophenyl)quinoline-4-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)c(F)c(F)c1F)c1cc(-c2cccc(Br)c2)nc2ccccc12 |
| InChI | InChI=1S/C22H10BrF5N2O/c23-11-5-3-4-10(8-11)15-9-13(12-6-1-2-7-14(12)29-15)22(31)30-21-19(27)17(25)16(24)18(26)20(21)28/h1-9H,(H,30,31) |
| InChIKey | DOYGTVJKXQULTC-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.23 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|