C20H17BrN2O3 — CID 2129067
[2-(ethylamino)-2-oxoethyl] 2-(3-bromophenyl)quinoline-4-carboxylate (PubChem CID 2129067) has the molecular formula C20H17BrN2O3 and a molecular weight of 413.27 g/mol. Its IUPAC name is [2-(ethylamino)-2-oxoethyl] 2-(3-bromophenyl)quinoline-4-carboxylate.
| Compound Name | [2-(ethylamino)-2-oxoethyl] 2-(3-bromophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2129067 |
| Molecular Formula | C20H17BrN2O3 |
| Molecular Weight | 413.27 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | [2-(ethylamino)-2-oxoethyl] 2-(3-bromophenyl)quinoline-4-carboxylate |
| SMILES | CCNC(=O)COC(=O)c1cc(-c2cccc(Br)c2)nc2ccccc12 |
| InChI | InChI=1S/C20H17BrN2O3/c1-2-22-19(24)12-26-20(25)16-11-18(13-6-5-7-14(21)10-13)23-17-9-4-3-8-15(16)17/h3-11H,2,12H2,1H3,(H,22,24) |
| InChIKey | ZDEBWTGCCKVOAS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.27 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |