[2-(3,4-dimethoxyphenyl)quinolin-4-yl] hydrogen carbonate

C18H15NO5 — CID 70367689

IUPAC[2-(3,4-dimethoxyphenyl)quinolin-4-yl] hydrogen carbonate
SMILESCOc1ccc(-c2cc(OC(=O)O)c3ccccc3n2)cc1OC
InChIInChI=1S/C18H15NO5/c1-22-15-8-7-11(9-17(15)23-2)14-10-16(24-18(20)21)12-5-3-4-6-13(12)19-14/h3-10H,1-2H3,(H,20,21)
InChIKeyKIONPDTWIRHWNJ-UHFFFAOYSA-N
MW325.32 g/mol
LogP3.98
Rot. Bonds4

About [2-(3,4-dimethoxyphenyl)quinolin-4-yl] hydrogen carbonate

[2-(3,4-dimethoxyphenyl)quinolin-4-yl] hydrogen carbonate (PubChem CID 70367689) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)quinolin-4-yl] hydrogen carbonate.

Molecular Properties

Compound Name[2-(3,4-dimethoxyphenyl)quinolin-4-yl] hydrogen carbonate
PubChem CID70367689
Molecular FormulaC18H15NO5
Molecular Weight325.32 g/mol
Exact Mass325.10
IUPAC Name[2-(3,4-dimethoxyphenyl)quinolin-4-yl] hydrogen carbonate
SMILESCOc1ccc(-c2cc(OC(=O)O)c3ccccc3n2)cc1OC
InChIInChI=1S/C18H15NO5/c1-22-15-8-7-11(9-17(15)23-2)14-10-16(24-18(20)21)12-5-3-4-6-13(12)19-14/h3-10H,1-2H3,(H,20,21)
InChIKeyKIONPDTWIRHWNJ-UHFFFAOYSA-N
XLogP3.98
TPSA77.88 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500325.32
LogP ≤ 53.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze [2-(3,4-dimethoxyphenyl)quinolin-4-yl] hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(3,4-dimethoxyphenyl)quinolin-4-yl] hydrogen carbonate?
The IUPAC name of [2-(3,4-dimethoxyphenyl)quinolin-4-yl] hydrogen carbonate (CID 70367689) is [2-(3,4-dimethoxyphenyl)quinolin-4-yl] hydrogen carbonate.
What is the SMILES notation for [2-(3,4-dimethoxyphenyl)quinolin-4-yl] hydrogen carbonate?
The canonical SMILES for [2-(3,4-dimethoxyphenyl)quinolin-4-yl] hydrogen carbonate is COc1ccc(-c2cc(OC(=O)O)c3ccccc3n2)cc1OC.
What is the InChIKey of [2-(3,4-dimethoxyphenyl)quinolin-4-yl] hydrogen carbonate?
The InChIKey is KIONPDTWIRHWNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO5/c1-22-15-8-7-11(9-17(15)23-2)14-10-16(24-18(20)21)12-5-3-4-6-13(12)19-14/h3-10H,1-2H3,(H,20,21).
What are the key properties of [2-(3,4-dimethoxyphenyl)quinolin-4-yl] hydrogen carbonate?
[2-(3,4-dimethoxyphenyl)quinolin-4-yl] hydrogen carbonate has a molecular weight of 325.32 g/mol, XLogP of 3.98, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-dimethoxyphenyl)quinolin-4-yl] hydrogen carbonate is sourced from PubChem (CID 70367689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).