C19H16NO4- — CID 4745196
2-(3,4-dimethoxyphenyl)-6-methylquinoline-4-carboxylate (PubChem CID 4745196) has the molecular formula C19H16NO4- and a molecular weight of 322.34 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-6-methylquinoline-4-carboxylate.
| Compound Name | 2-(3,4-dimethoxyphenyl)-6-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 4745196 |
| Molecular Formula | C19H16NO4- |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-6-methylquinoline-4-carboxylate |
| SMILES | COc1ccc(-c2cc(C(=O)[O-])c3cc(C)ccc3n2)cc1OC |
| InChI | InChI=1S/C19H17NO4/c1-11-4-6-15-13(8-11)14(19(21)22)10-16(20-15)12-5-7-17(23-2)18(9-12)24-3/h4-10H,1-3H3,(H,21,22)/p-1 |
| InChIKey | YOMZOJBFPXHVHU-UHFFFAOYSA-M |
| XLogP | 2.59 |
| TPSA | 71.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |