C18H14NO3- — CID 4744706
2-(3-methoxyphenyl)-6-methylquinoline-4-carboxylate (PubChem CID 4744706) has the molecular formula C18H14NO3- and a molecular weight of 292.31 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-6-methylquinoline-4-carboxylate.
| Compound Name | 2-(3-methoxyphenyl)-6-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 4744706 |
| Molecular Formula | C18H14NO3- |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-(3-methoxyphenyl)-6-methylquinoline-4-carboxylate |
| SMILES | COc1cccc(-c2cc(C(=O)[O-])c3cc(C)ccc3n2)c1 |
| InChI | InChI=1S/C18H15NO3/c1-11-6-7-16-14(8-11)15(18(20)21)10-17(19-16)12-4-3-5-13(9-12)22-2/h3-10H,1-2H3,(H,20,21)/p-1 |
| InChIKey | MMWABPDZOOUCOI-UHFFFAOYSA-M |
| XLogP | 2.58 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |