C19H18N2O5S — CID 3889769
6-(dimethylsulfamoyl)-2-(3-methoxyphenyl)quinoline-4-carboxylic acid (PubChem CID 3889769) has the molecular formula C19H18N2O5S and a molecular weight of 386.43 g/mol. Its IUPAC name is 6-(dimethylsulfamoyl)-2-(3-methoxyphenyl)quinoline-4-carboxylic acid.
| Compound Name | 6-(dimethylsulfamoyl)-2-(3-methoxyphenyl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 3889769 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 6-(dimethylsulfamoyl)-2-(3-methoxyphenyl)quinoline-4-carboxylic acid |
| SMILES | COc1cccc(-c2cc(C(=O)O)c3cc(S(=O)(=O)N(C)C)ccc3n2)c1 |
| InChI | InChI=1S/C19H18N2O5S/c1-21(2)27(24,25)14-7-8-17-15(10-14)16(19(22)23)11-18(20-17)12-5-4-6-13(9-12)26-3/h4-11H,1-3H3,(H,22,23) |
| InChIKey | NNRWVZUSHHAXKY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |