C21H22N2O4S — CID 4645947
6-(dimethylsulfamoyl)-2-(4-propan-2-ylphenyl)quinoline-4-carboxylic acid (PubChem CID 4645947) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is 6-(dimethylsulfamoyl)-2-(4-propan-2-ylphenyl)quinoline-4-carboxylic acid.
| Compound Name | 6-(dimethylsulfamoyl)-2-(4-propan-2-ylphenyl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 4645947 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 6-(dimethylsulfamoyl)-2-(4-propan-2-ylphenyl)quinoline-4-carboxylic acid |
| SMILES | CC(C)c1ccc(-c2cc(C(=O)O)c3cc(S(=O)(=O)N(C)C)ccc3n2)cc1 |
| InChI | InChI=1S/C21H22N2O4S/c1-13(2)14-5-7-15(8-6-14)20-12-18(21(24)25)17-11-16(9-10-19(17)22-20)28(26,27)23(3)4/h5-13H,1-4H3,(H,24,25) |
| InChIKey | ITXDYMDNBOGXBW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |