C30H31N3O — CID 4283982
[6-methyl-2-(4-propan-2-ylphenyl)quinolin-4-yl]-(4-phenylpiperazin-1-yl)methanone (PubChem CID 4283982) has the molecular formula C30H31N3O and a molecular weight of 449.60 g/mol. Its IUPAC name is [6-methyl-2-(4-propan-2-ylphenyl)quinolin-4-yl]-(4-phenylpiperazin-1-yl)methanone.
| Compound Name | [6-methyl-2-(4-propan-2-ylphenyl)quinolin-4-yl]-(4-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 4283982 |
| Molecular Formula | C30H31N3O |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | [6-methyl-2-(4-propan-2-ylphenyl)quinolin-4-yl]-(4-phenylpiperazin-1-yl)methanone |
| SMILES | Cc1ccc2nc(-c3ccc(C(C)C)cc3)cc(C(=O)N3CCN(c4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C30H31N3O/c1-21(2)23-10-12-24(13-11-23)29-20-27(26-19-22(3)9-14-28(26)31-29)30(34)33-17-15-32(16-18-33)25-7-5-4-6-8-25/h4-14,19-21H,15-18H2,1-3H3 |
| InChIKey | BPUHCSIBWUKCLD-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |