C27H24ClN3O — CID 17372354
(7-chloro-8-methyl-2-phenylquinolin-4-yl)-(4-phenylpiperazin-1-yl)methanone (PubChem CID 17372354) has the molecular formula C27H24ClN3O and a molecular weight of 441.96 g/mol. Its IUPAC name is (7-chloro-8-methyl-2-phenylquinolin-4-yl)-(4-phenylpiperazin-1-yl)methanone.
| Compound Name | (7-chloro-8-methyl-2-phenylquinolin-4-yl)-(4-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 17372354 |
| Molecular Formula | C27H24ClN3O |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | (7-chloro-8-methyl-2-phenylquinolin-4-yl)-(4-phenylpiperazin-1-yl)methanone |
| SMILES | Cc1c(Cl)ccc2c(C(=O)N3CCN(c4ccccc4)CC3)cc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C27H24ClN3O/c1-19-24(28)13-12-22-23(18-25(29-26(19)22)20-8-4-2-5-9-20)27(32)31-16-14-30(15-17-31)21-10-6-3-7-11-21/h2-13,18H,14-17H2,1H3 |
| InChIKey | FIBWMKBGXYAGDC-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |