C26H22ClN3O — CID 1023295
[2-(2-chlorophenyl)quinolin-4-yl]-(4-phenylpiperazin-1-yl)methanone (PubChem CID 1023295) has the molecular formula C26H22ClN3O and a molecular weight of 427.94 g/mol. Its IUPAC name is [2-(2-chlorophenyl)quinolin-4-yl]-(4-phenylpiperazin-1-yl)methanone.
| Compound Name | [2-(2-chlorophenyl)quinolin-4-yl]-(4-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 1023295 |
| Molecular Formula | C26H22ClN3O |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | [2-(2-chlorophenyl)quinolin-4-yl]-(4-phenylpiperazin-1-yl)methanone |
| SMILES | O=C(c1cc(-c2ccccc2Cl)nc2ccccc12)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H22ClN3O/c27-23-12-6-4-11-21(23)25-18-22(20-10-5-7-13-24(20)28-25)26(31)30-16-14-29(15-17-30)19-8-2-1-3-9-19/h1-13,18H,14-17H2 |
| InChIKey | CXVJYDSWEXRDFB-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |