C30H24ClN3OS — CID 162654911
[4-(3-chlorophenyl)piperazin-1-yl]-(2-phenyl-8-thiophen-2-ylquinolin-4-yl)methanone (PubChem CID 162654911) has the molecular formula C30H24ClN3OS and a molecular weight of 510.06 g/mol. Its IUPAC name is [4-(3-chlorophenyl)piperazin-1-yl]-(2-phenyl-8-thiophen-2-ylquinolin-4-yl)methanone.
| Compound Name | [4-(3-chlorophenyl)piperazin-1-yl]-(2-phenyl-8-thiophen-2-ylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 162654911 |
| Molecular Formula | C30H24ClN3OS |
| Molecular Weight | 510.06 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | [4-(3-chlorophenyl)piperazin-1-yl]-(2-phenyl-8-thiophen-2-ylquinolin-4-yl)methanone |
| SMILES | O=C(c1cc(-c2ccccc2)nc2c(-c3cccs3)cccc12)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C30H24ClN3OS/c31-22-9-4-10-23(19-22)33-14-16-34(17-15-33)30(35)26-20-27(21-7-2-1-3-8-21)32-29-24(26)11-5-12-25(29)28-13-6-18-36-28/h1-13,18-20H,14-17H2 |
| InChIKey | ZPLSVZYVWADIRE-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.06 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |