C25H22ClN3O3S — CID 55369602
2-(4-chlorophenyl)-N-methyl-N-[1-(4-sulfamoylphenyl)ethyl]quinoline-4-carboxamide (PubChem CID 55369602) has the molecular formula C25H22ClN3O3S and a molecular weight of 479.99 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-methyl-N-[1-(4-sulfamoylphenyl)ethyl]quinoline-4-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-methyl-N-[1-(4-sulfamoylphenyl)ethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 55369602 |
| Molecular Formula | C25H22ClN3O3S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | 2-(4-chlorophenyl)-N-methyl-N-[1-(4-sulfamoylphenyl)ethyl]quinoline-4-carboxamide |
| SMILES | CC(c1ccc(S(N)(=O)=O)cc1)N(C)C(=O)c1cc(-c2ccc(Cl)cc2)nc2ccccc12 |
| InChI | InChI=1S/C25H22ClN3O3S/c1-16(17-9-13-20(14-10-17)33(27,31)32)29(2)25(30)22-15-24(18-7-11-19(26)12-8-18)28-23-6-4-3-5-21(22)23/h3-16H,1-2H3,(H2,27,31,32) |
| InChIKey | KJHNNVIMCSKPSY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |