C23H17Cl2N3O3S — CID 4613486
2-(3,4-dichlorophenyl)-N-[(4-sulfamoylphenyl)methyl]quinoline-4-carboxamide (PubChem CID 4613486) has the molecular formula C23H17Cl2N3O3S and a molecular weight of 486.38 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-[(4-sulfamoylphenyl)methyl]quinoline-4-carboxamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-[(4-sulfamoylphenyl)methyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4613486 |
| Molecular Formula | C23H17Cl2N3O3S |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-[(4-sulfamoylphenyl)methyl]quinoline-4-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)c2cc(-c3ccc(Cl)c(Cl)c3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C23H17Cl2N3O3S/c24-19-10-7-15(11-20(19)25)22-12-18(17-3-1-2-4-21(17)28-22)23(29)27-13-14-5-8-16(9-6-14)32(26,30)31/h1-12H,13H2,(H,27,29)(H2,26,30,31) |
| InChIKey | QKSRGSXQGJEOSN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |