C19H14Cl2N2O — CID 5209906
2-(3,4-dichlorophenyl)-N-prop-2-enylquinoline-4-carboxamide (PubChem CID 5209906) has the molecular formula C19H14Cl2N2O and a molecular weight of 357.24 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-prop-2-enylquinoline-4-carboxamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-prop-2-enylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 5209906 |
| Molecular Formula | C19H14Cl2N2O |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-prop-2-enylquinoline-4-carboxamide |
| SMILES | C=CCNC(=O)c1cc(-c2ccc(Cl)c(Cl)c2)nc2ccccc12 |
| InChI | InChI=1S/C19H14Cl2N2O/c1-2-9-22-19(24)14-11-18(12-7-8-15(20)16(21)10-12)23-17-6-4-3-5-13(14)17/h2-8,10-11H,1,9H2,(H,22,24) |
| InChIKey | LSQGDLRTFDSKNV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|