C20H18N4OS — CID 12938019
1-[(2-phenylquinoline-4-carbonyl)amino]-3-prop-2-enylthiourea (PubChem CID 12938019) has the molecular formula C20H18N4OS and a molecular weight of 362.46 g/mol. Its IUPAC name is 1-[(2-phenylquinoline-4-carbonyl)amino]-3-prop-2-enylthiourea.
| Compound Name | 1-[(2-phenylquinoline-4-carbonyl)amino]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 12938019 |
| Molecular Formula | C20H18N4OS |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 1-[(2-phenylquinoline-4-carbonyl)amino]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NNC(=O)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C20H18N4OS/c1-2-12-21-20(26)24-23-19(25)16-13-18(14-8-4-3-5-9-14)22-17-11-7-6-10-15(16)17/h2-11,13H,1,12H2,(H,23,25)(H2,21,24,26) |
| InChIKey | WQVXGGLRDTYVCZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|