C19H19N5O2S — CID 24819782
1-(2-methoxyethyl)-3-[(2-pyridin-3-ylquinoline-4-carbonyl)amino]thiourea (PubChem CID 24819782) has the molecular formula C19H19N5O2S and a molecular weight of 381.46 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-[(2-pyridin-3-ylquinoline-4-carbonyl)amino]thiourea.
| Compound Name | 1-(2-methoxyethyl)-3-[(2-pyridin-3-ylquinoline-4-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 24819782 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 1-(2-methoxyethyl)-3-[(2-pyridin-3-ylquinoline-4-carbonyl)amino]thiourea |
| SMILES | COCCNC(=S)NNC(=O)c1cc(-c2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C19H19N5O2S/c1-26-10-9-21-19(27)24-23-18(25)15-11-17(13-5-4-8-20-12-13)22-16-7-3-2-6-14(15)16/h2-8,11-12H,9-10H2,1H3,(H,23,25)(H2,21,24,27) |
| InChIKey | OEBSWCHNQNEYOL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|