C25H21N5O3S — CID 1297375
ethyl 4-[[(2-pyridin-3-ylquinoline-4-carbonyl)amino]carbamothioylamino]benzoate (PubChem CID 1297375) has the molecular formula C25H21N5O3S and a molecular weight of 471.54 g/mol. Its IUPAC name is ethyl 4-[[(2-pyridin-3-ylquinoline-4-carbonyl)amino]carbamothioylamino]benzoate.
| Compound Name | ethyl 4-[[(2-pyridin-3-ylquinoline-4-carbonyl)amino]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 1297375 |
| Molecular Formula | C25H21N5O3S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | ethyl 4-[[(2-pyridin-3-ylquinoline-4-carbonyl)amino]carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)NNC(=O)c2cc(-c3cccnc3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C25H21N5O3S/c1-2-33-24(32)16-9-11-18(12-10-16)27-25(34)30-29-23(31)20-14-22(17-6-5-13-26-15-17)28-21-8-4-3-7-19(20)21/h3-15H,2H2,1H3,(H,29,31)(H2,27,30,34) |
| InChIKey | IFUOSOFJQBLXFG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|