C24H21N5OS — CID 24651612
1-(2,6-dimethylphenyl)-3-[(2-pyridin-4-ylquinoline-4-carbonyl)amino]thiourea (PubChem CID 24651612) has the molecular formula C24H21N5OS and a molecular weight of 427.53 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[(2-pyridin-4-ylquinoline-4-carbonyl)amino]thiourea.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[(2-pyridin-4-ylquinoline-4-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 24651612 |
| Molecular Formula | C24H21N5OS |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[(2-pyridin-4-ylquinoline-4-carbonyl)amino]thiourea |
| SMILES | Cc1cccc(C)c1NC(=S)NNC(=O)c1cc(-c2ccncc2)nc2ccccc12 |
| InChI | InChI=1S/C24H21N5OS/c1-15-6-5-7-16(2)22(15)27-24(31)29-28-23(30)19-14-21(17-10-12-25-13-11-17)26-20-9-4-3-8-18(19)20/h3-14H,1-2H3,(H,28,30)(H2,27,29,31) |
| InChIKey | QGQGGEKGYSNMMK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|