C24H21N5O2 — CID 25394120
N'-[4-(dimethylamino)benzoyl]-2-pyridin-4-ylquinoline-4-carbohydrazide (PubChem CID 25394120) has the molecular formula C24H21N5O2 and a molecular weight of 411.47 g/mol. Its IUPAC name is N'-[4-(dimethylamino)benzoyl]-2-pyridin-4-ylquinoline-4-carbohydrazide.
| Compound Name | N'-[4-(dimethylamino)benzoyl]-2-pyridin-4-ylquinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 25394120 |
| Molecular Formula | C24H21N5O2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N'-[4-(dimethylamino)benzoyl]-2-pyridin-4-ylquinoline-4-carbohydrazide |
| SMILES | CN(C)c1ccc(C(=O)NNC(=O)c2cc(-c3ccncc3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C24H21N5O2/c1-29(2)18-9-7-17(8-10-18)23(30)27-28-24(31)20-15-22(16-11-13-25-14-12-16)26-21-6-4-3-5-19(20)21/h3-15H,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | KAINFHFBRLIQHY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|