C29H22N4O3 — CID 26796355
N'-[2-(2-phenylphenoxy)acetyl]-2-pyridin-4-ylquinoline-4-carbohydrazide (PubChem CID 26796355) has the molecular formula C29H22N4O3 and a molecular weight of 474.52 g/mol. Its IUPAC name is N'-[2-(2-phenylphenoxy)acetyl]-2-pyridin-4-ylquinoline-4-carbohydrazide.
| Compound Name | N'-[2-(2-phenylphenoxy)acetyl]-2-pyridin-4-ylquinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 26796355 |
| Molecular Formula | C29H22N4O3 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | N'-[2-(2-phenylphenoxy)acetyl]-2-pyridin-4-ylquinoline-4-carbohydrazide |
| SMILES | O=C(COc1ccccc1-c1ccccc1)NNC(=O)c1cc(-c2ccncc2)nc2ccccc12 |
| InChI | InChI=1S/C29H22N4O3/c34-28(19-36-27-13-7-5-10-22(27)20-8-2-1-3-9-20)32-33-29(35)24-18-26(21-14-16-30-17-15-21)31-25-12-6-4-11-23(24)25/h1-18H,19H2,(H,32,34)(H,33,35) |
| InChIKey | CZMZOLPOEXLJKY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|