C22H20N4O2 — CID 25354662
N'-[2-[(1S)-cyclopent-2-en-1-yl]acetyl]-2-pyridin-4-ylquinoline-4-carbohydrazide (PubChem CID 25354662) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is N'-[2-[(1S)-cyclopent-2-en-1-yl]acetyl]-2-pyridin-4-ylquinoline-4-carbohydrazide.
| Compound Name | N'-[2-[(1S)-cyclopent-2-en-1-yl]acetyl]-2-pyridin-4-ylquinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 25354662 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | N'-[2-[(1S)-cyclopent-2-en-1-yl]acetyl]-2-pyridin-4-ylquinoline-4-carbohydrazide |
| SMILES | O=C(C[C@H]1C=CCC1)NNC(=O)c1cc(-c2ccncc2)nc2ccccc12 |
| InChI | InChI=1S/C22H20N4O2/c27-21(13-15-5-1-2-6-15)25-26-22(28)18-14-20(16-9-11-23-12-10-16)24-19-8-4-3-7-17(18)19/h1,3-5,7-12,14-15H,2,6,13H2,(H,25,27)(H,26,28)/t15-/m0/s1 |
| InChIKey | TZOCRXQQAOZESV-HNNXBMFYSA-N |
| XLogP | 3.41 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|