C22H23FN2O — CID 55530881
2-(4-fluorophenyl)-N,N-di(propan-2-yl)quinoline-4-carboxamide (PubChem CID 55530881) has the molecular formula C22H23FN2O and a molecular weight of 350.44 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N,N-di(propan-2-yl)quinoline-4-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N,N-di(propan-2-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 55530881 |
| Molecular Formula | C22H23FN2O |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 2-(4-fluorophenyl)-N,N-di(propan-2-yl)quinoline-4-carboxamide |
| SMILES | CC(C)N(C(=O)c1cc(-c2ccc(F)cc2)nc2ccccc12)C(C)C |
| InChI | InChI=1S/C22H23FN2O/c1-14(2)25(15(3)4)22(26)19-13-21(16-9-11-17(23)12-10-16)24-20-8-6-5-7-18(19)20/h5-15H,1-4H3 |
| InChIKey | MTAVWJILHFKHIV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |