C9H10ClNO4S — CID 2324784
2-chloro-5-(dimethylsulfamoyl)benzoic acid (PubChem CID 2324784) has the molecular formula C9H10ClNO4S and a molecular weight of 263.70 g/mol. Its IUPAC name is 2-chloro-5-(dimethylsulfamoyl)benzoic acid.
| Compound Name | 2-chloro-5-(dimethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 2324784 |
| Molecular Formula | C9H10ClNO4S |
| Molecular Weight | 263.70 g/mol |
| Exact Mass | 263.00 |
| IUPAC Name | 2-chloro-5-(dimethylsulfamoyl)benzoic acid |
| SMILES | CN(C)S(=O)(=O)c1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C9H10ClNO4S/c1-11(2)16(14,15)6-3-4-8(10)7(5-6)9(12)13/h3-5H,1-2H3,(H,12,13) |
| InChIKey | GHZFXVLKFOAKRO-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.70 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |