C11H12Cl3NO4S — CID 70536672
2-chloro-5-[2,2-dichloroethyl(ethyl)sulfamoyl]benzoic acid (PubChem CID 70536672) has the molecular formula C11H12Cl3NO4S and a molecular weight of 360.65 g/mol. Its IUPAC name is 2-chloro-5-[2,2-dichloroethyl(ethyl)sulfamoyl]benzoic acid.
| Compound Name | 2-chloro-5-[2,2-dichloroethyl(ethyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 70536672 |
| Molecular Formula | C11H12Cl3NO4S |
| Molecular Weight | 360.65 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | 2-chloro-5-[2,2-dichloroethyl(ethyl)sulfamoyl]benzoic acid |
| SMILES | CCN(CC(Cl)Cl)S(=O)(=O)c1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H12Cl3NO4S/c1-2-15(6-10(13)14)20(18,19)7-3-4-9(12)8(5-7)11(16)17/h3-5,10H,2,6H2,1H3,(H,16,17) |
| InChIKey | ASEJOJBWHCEGDH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.65 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|