C26H22NO4- — CID 7139751
2-[3-methoxy-4-(2-phenylethoxy)phenyl]-6-methylquinoline-4-carboxylate (PubChem CID 7139751) has the molecular formula C26H22NO4- and a molecular weight of 412.47 g/mol. Its IUPAC name is 2-[3-methoxy-4-(2-phenylethoxy)phenyl]-6-methylquinoline-4-carboxylate.
| Compound Name | 2-[3-methoxy-4-(2-phenylethoxy)phenyl]-6-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 7139751 |
| Molecular Formula | C26H22NO4- |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2-[3-methoxy-4-(2-phenylethoxy)phenyl]-6-methylquinoline-4-carboxylate |
| SMILES | COc1cc(-c2cc(C(=O)[O-])c3cc(C)ccc3n2)ccc1OCCc1ccccc1 |
| InChI | InChI=1S/C26H23NO4/c1-17-8-10-22-20(14-17)21(26(28)29)16-23(27-22)19-9-11-24(25(15-19)30-2)31-13-12-18-6-4-3-5-7-18/h3-11,14-16H,12-13H2,1-2H3,(H,28,29)/p-1 |
| InChIKey | ROPNCMJNQQGLRY-UHFFFAOYSA-M |
| XLogP | 4.20 |
| TPSA | 71.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |