C27H24NO4- — CID 7139755
2-[3-methoxy-4-(3-phenylpropoxy)phenyl]-6-methylquinoline-4-carboxylate (PubChem CID 7139755) has the molecular formula C27H24NO4- and a molecular weight of 426.49 g/mol. Its IUPAC name is 2-[3-methoxy-4-(3-phenylpropoxy)phenyl]-6-methylquinoline-4-carboxylate.
| Compound Name | 2-[3-methoxy-4-(3-phenylpropoxy)phenyl]-6-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 7139755 |
| Molecular Formula | C27H24NO4- |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 2-[3-methoxy-4-(3-phenylpropoxy)phenyl]-6-methylquinoline-4-carboxylate |
| SMILES | COc1cc(-c2cc(C(=O)[O-])c3cc(C)ccc3n2)ccc1OCCCc1ccccc1 |
| InChI | InChI=1S/C27H25NO4/c1-18-10-12-23-21(15-18)22(27(29)30)17-24(28-23)20-11-13-25(26(16-20)31-2)32-14-6-9-19-7-4-3-5-8-19/h3-5,7-8,10-13,15-17H,6,9,14H2,1-2H3,(H,29,30)/p-1 |
| InChIKey | TUVNAXRXPCJDGN-UHFFFAOYSA-M |
| XLogP | 4.59 |
| TPSA | 71.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|