C32H28N2O2 — CID 42659177
N-(1,2-diphenylethyl)-2-(3-methoxyphenyl)-6-methylquinoline-4-carboxamide (PubChem CID 42659177) has the molecular formula C32H28N2O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is N-(1,2-diphenylethyl)-2-(3-methoxyphenyl)-6-methylquinoline-4-carboxamide.
| Compound Name | N-(1,2-diphenylethyl)-2-(3-methoxyphenyl)-6-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 42659177 |
| Molecular Formula | C32H28N2O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | N-(1,2-diphenylethyl)-2-(3-methoxyphenyl)-6-methylquinoline-4-carboxamide |
| SMILES | COc1cccc(-c2cc(C(=O)NC(Cc3ccccc3)c3ccccc3)c3cc(C)ccc3n2)c1 |
| InChI | InChI=1S/C32H28N2O2/c1-22-16-17-29-27(18-22)28(21-31(33-29)25-14-9-15-26(20-25)36-2)32(35)34-30(24-12-7-4-8-13-24)19-23-10-5-3-6-11-23/h3-18,20-21,30H,19H2,1-2H3,(H,34,35) |
| InChIKey | OJNSUJPUJSEQJQ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |