C25H21FN2O — CID 7237810
N-[(1S)-1,2-diphenylethyl]-6-fluoro-2-methylquinoline-4-carboxamide (PubChem CID 7237810) has the molecular formula C25H21FN2O and a molecular weight of 384.45 g/mol. Its IUPAC name is N-[(1S)-1,2-diphenylethyl]-6-fluoro-2-methylquinoline-4-carboxamide.
| Compound Name | N-[(1S)-1,2-diphenylethyl]-6-fluoro-2-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 7237810 |
| Molecular Formula | C25H21FN2O |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N-[(1S)-1,2-diphenylethyl]-6-fluoro-2-methylquinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@@H](Cc2ccccc2)c2ccccc2)c2cc(F)ccc2n1 |
| InChI | InChI=1S/C25H21FN2O/c1-17-14-22(21-16-20(26)12-13-23(21)27-17)25(29)28-24(19-10-6-3-7-11-19)15-18-8-4-2-5-9-18/h2-14,16,24H,15H2,1H3,(H,28,29)/t24-/m0/s1 |
| InChIKey | KGYURYZZZWRHNG-DEOSSOPVSA-N |
| XLogP | 5.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |