C19H16FN3O2 — CID 4732359
6-fluoro-2-methyl-N'-(2-phenylacetyl)quinoline-4-carbohydrazide (PubChem CID 4732359) has the molecular formula C19H16FN3O2 and a molecular weight of 337.35 g/mol. Its IUPAC name is 6-fluoro-2-methyl-N'-(2-phenylacetyl)quinoline-4-carbohydrazide.
| Compound Name | 6-fluoro-2-methyl-N'-(2-phenylacetyl)quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 4732359 |
| Molecular Formula | C19H16FN3O2 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 6-fluoro-2-methyl-N'-(2-phenylacetyl)quinoline-4-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)Cc2ccccc2)c2cc(F)ccc2n1 |
| InChI | InChI=1S/C19H16FN3O2/c1-12-9-16(15-11-14(20)7-8-17(15)21-12)19(25)23-22-18(24)10-13-5-3-2-4-6-13/h2-9,11H,10H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | HMMZQTFEJDHIFK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|