C18H12FIN2O3 — CID 108789589
2-[(6-fluoro-2-methylquinoline-4-carbonyl)amino]-5-iodobenzoic acid (PubChem CID 108789589) has the molecular formula C18H12FIN2O3 and a molecular weight of 450.21 g/mol. Its IUPAC name is 2-[(6-fluoro-2-methylquinoline-4-carbonyl)amino]-5-iodobenzoic acid.
| Compound Name | 2-[(6-fluoro-2-methylquinoline-4-carbonyl)amino]-5-iodobenzoic acid |
|---|---|
| PubChem CID | 108789589 |
| Molecular Formula | C18H12FIN2O3 |
| Molecular Weight | 450.21 g/mol |
| Exact Mass | 449.99 |
| IUPAC Name | 2-[(6-fluoro-2-methylquinoline-4-carbonyl)amino]-5-iodobenzoic acid |
| SMILES | Cc1cc(C(=O)Nc2ccc(I)cc2C(=O)O)c2cc(F)ccc2n1 |
| InChI | InChI=1S/C18H12FIN2O3/c1-9-6-13(12-7-10(19)2-4-15(12)21-9)17(23)22-16-5-3-11(20)8-14(16)18(24)25/h2-8H,1H3,(H,22,23)(H,24,25) |
| InChIKey | LWYSDOWSFJLMLM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.21 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|