C17H13FN2O2 — CID 108789542
6-fluoro-N-(3-hydroxyphenyl)-2-methylquinoline-4-carboxamide (PubChem CID 108789542) has the molecular formula C17H13FN2O2 and a molecular weight of 296.30 g/mol. Its IUPAC name is 6-fluoro-N-(3-hydroxyphenyl)-2-methylquinoline-4-carboxamide.
| Compound Name | 6-fluoro-N-(3-hydroxyphenyl)-2-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 108789542 |
| Molecular Formula | C17H13FN2O2 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 6-fluoro-N-(3-hydroxyphenyl)-2-methylquinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cccc(O)c2)c2cc(F)ccc2n1 |
| InChI | InChI=1S/C17H13FN2O2/c1-10-7-15(14-8-11(18)5-6-16(14)19-10)17(22)20-12-3-2-4-13(21)9-12/h2-9,21H,1H3,(H,20,22) |
| InChIKey | PKJJUZBLLYKLAI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |