C22H20FN3O2 — CID 131889668
6-fluoro-2-methyl-N-[3-(2-methyl-5-oxopyrrolidin-1-yl)phenyl]quinoline-4-carboxamide (PubChem CID 131889668) has the molecular formula C22H20FN3O2 and a molecular weight of 377.42 g/mol. Its IUPAC name is 6-fluoro-2-methyl-N-[3-(2-methyl-5-oxopyrrolidin-1-yl)phenyl]quinoline-4-carboxamide.
| Compound Name | 6-fluoro-2-methyl-N-[3-(2-methyl-5-oxopyrrolidin-1-yl)phenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 131889668 |
| Molecular Formula | C22H20FN3O2 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 6-fluoro-2-methyl-N-[3-(2-methyl-5-oxopyrrolidin-1-yl)phenyl]quinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cccc(N3C(=O)CCC3C)c2)c2cc(F)ccc2n1 |
| InChI | InChI=1S/C22H20FN3O2/c1-13-10-19(18-11-15(23)7-8-20(18)24-13)22(28)25-16-4-3-5-17(12-16)26-14(2)6-9-21(26)27/h3-5,7-8,10-12,14H,6,9H2,1-2H3,(H,25,28) |
| InChIKey | PJLKKYFKDATFCR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |